ChemNet > CAS > 465514-69-6 3-[2-(3-klorofenil)asetil]benzonitril
465514-69-6 3-[2-(3-klorofenil)asetil]benzonitril
| Nama produk |
3-[2-(3-klorofenil)asetil]benzonitril |
| Sinonim |
3- [(3-klorofenil) asetil] benzonitrile |
| Nama bahasa Inggris |
3-[2-(3-chlorophenyl)acetyl]benzonitrile;3-[(3-chlorophenyl)acetyl]benzonitrile |
| MF |
C15H10ClNO |
| Berat Molekul |
255.699 |
| InChI |
InChI=1/C15H10ClNO/c16-14-6-2-3-11(8-14)9-15(18)13-5-1-4-12(7-13)10-17/h1-8H,9H2 |
| CAS NO |
465514-69-6 |
| Struktur Molekul |
|
| Kepadatan |
1.27g/cm3 |
| Titik lebur |
87.5℃ |
| Titik didih |
416.5°C at 760 mmHg |
| Indeks bias |
1.615 |
| Titik nyala |
205.7°C |
| Tekanan uap |
3.81E-07mmHg at 25°C |
| Simbol bahaya |
Xn:Harmful;
|
| Kode Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Keselamatan Deskripsi |
S36/37:Wear suitable protective clothing and gloves.;
|
|